C18H25NO2 — CID 140922731
1-[(3R,10bS)-9-methyl-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-3,3-dimethylbutan-2-one (PubChem CID 140922731) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-[(3R,10bS)-9-methyl-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[(3R,10bS)-9-methyl-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 140922731 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-[(3R,10bS)-9-methyl-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-3,3-dimethylbutan-2-one |
| SMILES | Cc1ccc2c(c1)[C@@H]1OC[C@@H](CC(=O)C(C)(C)C)N1CC2 |
| InChI | InChI=1S/C18H25NO2/c1-12-5-6-13-7-8-19-14(10-16(20)18(2,3)4)11-21-17(19)15(13)9-12/h5-6,9,14,17H,7-8,10-11H2,1-4H3/t14-,17+/m1/s1 |
| InChIKey | GOQFDHKNERFGFX-PBHICJAKSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |