C17H26O2 — CID 14092315
1,4-dibutyl-5,6,7,8-tetrahydroisochromen-3-one (PubChem CID 14092315) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1,4-dibutyl-5,6,7,8-tetrahydroisochromen-3-one.
| Compound Name | 1,4-dibutyl-5,6,7,8-tetrahydroisochromen-3-one |
|---|---|
| PubChem CID | 14092315 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1,4-dibutyl-5,6,7,8-tetrahydroisochromen-3-one |
| SMILES | CCCCc1oc(=O)c(CCCC)c2c1CCCC2 |
| InChI | InChI=1S/C17H26O2/c1-3-5-9-15-13-10-7-8-11-14(13)16(12-6-4-2)19-17(15)18/h3-12H2,1-2H3 |
| InChIKey | GJQVWUUDQIZPMA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |