C8H11N — CID 140923187
1,2,2,3,3,3a,4-heptadeuterio-4H-indole (PubChem CID 140923187) has the molecular formula C8H11N and a molecular weight of 128.23 g/mol. Its IUPAC name is 1,2,2,3,3,3a,4-heptadeuterio-4H-indole.
| Compound Name | 1,2,2,3,3,3a,4-heptadeuterio-4H-indole |
|---|---|
| PubChem CID | 140923187 |
| Molecular Formula | C8H11N |
| Molecular Weight | 128.23 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1,2,2,3,3,3a,4-heptadeuterio-4H-indole |
| SMILES | [2H]C1C=CC=C2N([2H])C([2H])([2H])C([2H])([2H])C21[2H] |
| InChI | InChI=1S/C8H11N/c1-2-4-8-7(3-1)5-6-9-8/h1-2,4,7,9H,3,5-6H2/i3D,5D2,6D2,7D/hD |
| InChIKey | FRUWMYWEARDNTC-LKHFKKQTSA-N |
| XLogP | 1.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |