C20H21N7O2S — CID 140923815
2-[1-butylsulfonyl-3-[4-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 140923815) has the molecular formula C20H21N7O2S and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-[1-butylsulfonyl-3-[4-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-butylsulfonyl-3-[4-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 140923815 |
| Molecular Formula | C20H21N7O2S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[1-butylsulfonyl-3-[4-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | [C-]#[N+]c1cnc2[nH]ccc2c1-c1cnn(C2(CC#N)CN(S(=O)(=O)CCCC)C2)c1 |
| InChI | InChI=1S/C20H21N7O2S/c1-3-4-9-30(28,29)26-13-20(14-26,6-7-21)27-12-15(10-25-27)18-16-5-8-23-19(16)24-11-17(18)22-2/h5,8,10-12H,3-4,6,9,13-14H2,1H3,(H,23,24) |
| InChIKey | UFAFAULIQZLJJM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|