C27H36N6O5S — CID 140923960
4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]bicyclo[2.2.2]octane-1-carbohydrazide (PubChem CID 140923960) has the molecular formula C27H36N6O5S and a molecular weight of 556.69 g/mol. Its IUPAC name is 4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]bicyclo[2.2.2]octane-1-carbohydrazide.
| Compound Name | 4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]bicyclo[2.2.2]octane-1-carbohydrazide |
|---|---|
| PubChem CID | 140923960 |
| Molecular Formula | C27H36N6O5S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]bicyclo[2.2.2]octane-1-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(NNC(=O)C45CCC(NC(O)OC(C)(C)C)(CC4)CC5)cnc32)cc1 |
| InChI | InChI=1S/C27H36N6O5S/c1-18-5-7-19(8-6-18)39(36,37)33-16-9-20-22(33)28-17-21(29-20)31-32-23(34)26-10-13-27(14-11-26,15-12-26)30-24(35)38-25(2,3)4/h5-9,16-17,24,30,35H,10-15H2,1-4H3,(H,29,31)(H,32,34) |
| InChIKey | DRHPGIOUZVKXJG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 147.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|