C44H27N5OSSi — CID 140924379
[1]benzofuro[2,3-b]pyridin-8-yl-diphenyl-[4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)-1,3,5-triazin-2-yl]silane (PubChem CID 140924379) has the molecular formula C44H27N5OSSi and a molecular weight of 701.89 g/mol. Its IUPAC name is [1]benzofuro[2,3-b]pyridin-8-yl-diphenyl-[4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)-1,3,5-triazin-2-yl]silane.
| Compound Name | [1]benzofuro[2,3-b]pyridin-8-yl-diphenyl-[4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)-1,3,5-triazin-2-yl]silane |
|---|---|
| PubChem CID | 140924379 |
| Molecular Formula | C44H27N5OSSi |
| Molecular Weight | 701.89 g/mol |
| Exact Mass | 701.17 |
| IUPAC Name | [1]benzofuro[2,3-b]pyridin-8-yl-diphenyl-[4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)-1,3,5-triazin-2-yl]silane |
| SMILES | c1ccc([Si](c2ccccc2)(c2ncnc(-n3c4ccccc4c4c5c(ccc43)sc3ccccc35)n2)c2cccc3c2oc2ncccc23)cc1 |
| InChI | InChI=1S/C44H27N5OSSi/c1-3-13-28(14-4-1)52(29-15-5-2-6-16-29,38-23-11-19-30-31-20-12-26-45-42(31)50-41(30)38)44-47-27-46-43(48-44)49-34-21-9-7-17-32(34)39-35(49)24-25-37-40(39)33-18-8-10-22-36(33)51-37/h1-27H |
| InChIKey | GSPXEJIIXWPTMI-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.89 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|