C14H16BF2NO5 — CID 140925419
(3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 140925419) has the molecular formula C14H16BF2NO5 and a molecular weight of 327.09 g/mol. Its IUPAC name is (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 140925419 |
| Molecular Formula | C14H16BF2NO5 |
| Molecular Weight | 327.09 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(F)(F)CCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C14H16BF2NO5/c1-14(16,17)6-5-11(19)18-10-7-8-3-2-4-9(13(20)21)12(8)23-15(10)22/h2-4,10,22H,5-7H2,1H3,(H,18,19)(H,20,21)/t10-/m0/s1 |
| InChIKey | UFUCRCNXQDSBQD-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.09 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|