C13H12BF3NNaO5 — CID 140925483
sodium 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140925483) has the molecular formula C13H12BF3NNaO5 and a molecular weight of 353.04 g/mol. Its IUPAC name is sodium 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | sodium 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140925483 |
| Molecular Formula | C13H12BF3NNaO5 |
| Molecular Weight | 353.04 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | sodium 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | O=C(CCC(F)(F)F)NC1Cc2cccc(C(=O)[O-])c2OB1O.[Na+] |
| InChI | InChI=1S/C13H13BF3NO5.Na/c15-13(16,17)5-4-10(19)18-9-6-7-2-1-3-8(12(20)21)11(7)23-14(9)22;/h1-3,9,22H,4-6H2,(H,18,19)(H,20,21);/q;+1/p-1 |
| InChIKey | IAJZJGCKUGXQAT-UHFFFAOYSA-M |
| XLogP | -3.16 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.04 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|