C14H15BF3NO5 — CID 140925493
(3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 140925493) has the molecular formula C14H15BF3NO5 and a molecular weight of 345.08 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 140925493 |
| Molecular Formula | C14H15BF3NO5 |
| Molecular Weight | 345.08 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(CCCC(F)(F)F)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C14H15BF3NO5/c16-14(17,18)6-2-5-11(20)19-10-7-8-3-1-4-9(13(21)22)12(8)24-15(10)23/h1,3-4,10,23H,2,5-7H2,(H,19,20)(H,21,22)/t10-/m0/s1 |
| InChIKey | AQFUJADRHBUDRG-JTQLQIEISA-N |
| XLogP | 1.56 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.08 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|