C13H14BF2NO5 — CID 140925526
(3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 140925526) has the molecular formula C13H14BF2NO5 and a molecular weight of 313.06 g/mol. Its IUPAC name is (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 140925526 |
| Molecular Formula | C13H14BF2NO5 |
| Molecular Weight | 313.06 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(F)(F)CC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C13H14BF2NO5/c1-13(15,16)6-10(18)17-9-5-7-3-2-4-8(12(19)20)11(7)22-14(9)21/h2-4,9,21H,5-6H2,1H3,(H,17,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | NWKRMINPBDCJPE-VIFPVBQESA-N |
| XLogP | 0.87 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.06 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|