C21H32N2O3Si — CID 140925833
2-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-2,5-diazaspiro[3.4]octane-3,6-dione (PubChem CID 140925833) has the molecular formula C21H32N2O3Si and a molecular weight of 388.58 g/mol. Its IUPAC name is 2-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-2,5-diazaspiro[3.4]octane-3,6-dione.
| Compound Name | 2-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-2,5-diazaspiro[3.4]octane-3,6-dione |
|---|---|
| PubChem CID | 140925833 |
| Molecular Formula | C21H32N2O3Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-2,5-diazaspiro[3.4]octane-3,6-dione |
| SMILES | CC1C(O[Si](C)(C)C(C)(C)C)C(=O)N(C)C12CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C21H32N2O3Si/c1-15-17(26-27(6,7)20(2,3)4)18(24)22(5)21(15)14-23(19(21)25)13-16-11-9-8-10-12-16/h8-12,15,17H,13-14H2,1-7H3 |
| InChIKey | RKSIEZWBLDAVOZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|