C60H54N2Si2 — CID 140926321
N-naphthalen-1-yl-6-[(E)-2-[6-(N-naphthalen-1-yl-4-trimethylsilylanilino)naphthalen-2-yl]ethenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine (PubChem CID 140926321) has the molecular formula C60H54N2Si2 and a molecular weight of 859.28 g/mol. Its IUPAC name is N-naphthalen-1-yl-6-[(E)-2-[6-(N-naphthalen-1-yl-4-trimethylsilylanilino)naphthalen-2-yl]ethenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine.
| Compound Name | N-naphthalen-1-yl-6-[(E)-2-[6-(N-naphthalen-1-yl-4-trimethylsilylanilino)naphthalen-2-yl]ethenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 140926321 |
| Molecular Formula | C60H54N2Si2 |
| Molecular Weight | 859.28 g/mol |
| Exact Mass | 858.38 |
| IUPAC Name | N-naphthalen-1-yl-6-[(E)-2-[6-(N-naphthalen-1-yl-4-trimethylsilylanilino)naphthalen-2-yl]ethenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccc3cc(/C=C/c4ccc5cc(N(c6ccc([Si](C)(C)C)cc6)c6cccc7ccccc67)ccc5c4)ccc3c2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C60H54N2Si2/c1-63(2,3)55-35-31-51(32-36-55)61(59-19-11-15-45-13-7-9-17-57(45)59)53-29-27-47-39-43(23-25-49(47)41-53)21-22-44-24-26-50-42-54(30-28-48(50)40-44)62(52-33-37-56(38-34-52)64(4,5)6)60-20-12-16-46-14-8-10-18-58(46)60/h7-42H,1-6H3/b22-21+ |
| InChIKey | UDEFXKJKHYXVAL-QURGRASLSA-N |
| XLogP | 16.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.28 |
| LogP ≤ 5 | 16.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|