C25H31N3OSi — CID 140926704
tert-butyl-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane (PubChem CID 140926704) has the molecular formula C25H31N3OSi and a molecular weight of 417.63 g/mol. Its IUPAC name is tert-butyl-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane |
|---|---|
| PubChem CID | 140926704 |
| Molecular Formula | C25H31N3OSi |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | tert-butyl-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1CCc2nnc(C3CC3)n2C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3OSi/c1-25(2,3)30(21-10-6-4-7-11-21,22-12-8-5-9-13-22)29-20-16-17-23-26-27-24(19-14-15-19)28(23)18-20/h4-13,19-20H,14-18H2,1-3H3 |
| InChIKey | RBOIMTWZUJCWDW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|