C11H21BF3NO2 — CID 140926718
(1R)-5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine (PubChem CID 140926718) has the molecular formula C11H21BF3NO2 and a molecular weight of 267.10 g/mol. Its IUPAC name is (1R)-5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine.
| Compound Name | (1R)-5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 140926718 |
| Molecular Formula | C11H21BF3NO2 |
| Molecular Weight | 267.10 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (1R)-5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine |
| SMILES | CC1(C)OB([C@@H](N)CCCC(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C11H21BF3NO2/c1-9(2)10(3,4)18-12(17-9)8(16)6-5-7-11(13,14)15/h8H,5-7,16H2,1-4H3/t8-/m0/s1 |
| InChIKey | OFUKBUXGPGRVSL-QMMMGPOBSA-N |
| XLogP | 2.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.10 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|