C39H43BF2N3O2+ — CID 140926856
[2,2-difluoro-10,12-dimethyl-6-[4-(10-pyridin-1-ium-1-yldecoxy)phenyl]-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl]-phenylmethanone (PubChem CID 140926856) has the molecular formula C39H43BF2N3O2+ and a molecular weight of 634.60 g/mol. Its IUPAC name is [2,2-difluoro-10,12-dimethyl-6-[4-(10-pyridin-1-ium-1-yldecoxy)phenyl]-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl]-phenylmethanone.
| Compound Name | [2,2-difluoro-10,12-dimethyl-6-[4-(10-pyridin-1-ium-1-yldecoxy)phenyl]-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 140926856 |
| Molecular Formula | C39H43BF2N3O2+ |
| Molecular Weight | 634.60 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | [2,2-difluoro-10,12-dimethyl-6-[4-(10-pyridin-1-ium-1-yldecoxy)phenyl]-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl]-phenylmethanone |
| SMILES | Cc1cc(C)n2c1C=C1C(c3ccc(OCCCCCCCCCC[n+]4ccccc4)cc3)=C(C(=O)c3ccccc3)C=[N+]1[B-]2(F)F |
| InChI | InChI=1S/C39H43BF2N3O2/c1-30-27-31(2)45-36(30)28-37-38(35(29-44(37)40(45,41)42)39(46)33-17-11-9-12-18-33)32-19-21-34(22-20-32)47-26-16-8-6-4-3-5-7-13-23-43-24-14-10-15-25-43/h9-12,14-15,17-22,24-25,27-29H,3-8,13,16,23,26H2,1-2H3/q+1 |
| InChIKey | YNSNLPIJXQEZOK-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 38.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.60 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|