C43H35BF2N2O2P+ — CID 140926857
[4-(5-benzoyl-2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl)phenoxy]methyl-triphenylphosphanium (PubChem CID 140926857) has the molecular formula C43H35BF2N2O2P+ and a molecular weight of 691.55 g/mol. Its IUPAC name is [4-(5-benzoyl-2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl)phenoxy]methyl-triphenylphosphanium.
| Compound Name | [4-(5-benzoyl-2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl)phenoxy]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 140926857 |
| Molecular Formula | C43H35BF2N2O2P+ |
| Molecular Weight | 691.55 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | [4-(5-benzoyl-2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl)phenoxy]methyl-triphenylphosphanium |
| SMILES | Cc1cc(C)n2c1C=C1C(c3ccc(OC[P+](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)=C(C(=O)c3ccccc3)C=[N+]1[B-]2(F)F |
| InChI | InChI=1S/C43H35BF2N2O2P/c1-31-27-32(2)48-40(31)28-41-42(39(29-47(41)44(48,45)46)43(49)34-15-7-3-8-16-34)33-23-25-35(26-24-33)50-30-51(36-17-9-4-10-18-36,37-19-11-5-12-20-37)38-21-13-6-14-22-38/h3-29H,30H2,1-2H3/q+1 |
| InChIKey | MJLYJNBAEIZIQQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.55 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|