C6H16Cl2OSi2Sn — CID 14092702
4,4-dichloro-2,2,6,6-tetramethyl-1,2,6,4-oxadisilastanninane (PubChem CID 14092702) has the molecular formula C6H16Cl2OSi2Sn and a molecular weight of 349.98 g/mol. Its IUPAC name is 4,4-dichloro-2,2,6,6-tetramethyl-1,2,6,4-oxadisilastanninane.
| Compound Name | 4,4-dichloro-2,2,6,6-tetramethyl-1,2,6,4-oxadisilastanninane |
|---|---|
| PubChem CID | 14092702 |
| Molecular Formula | C6H16Cl2OSi2Sn |
| Molecular Weight | 349.98 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 4,4-dichloro-2,2,6,6-tetramethyl-1,2,6,4-oxadisilastanninane |
| SMILES | C[Si]1(C)C[Sn](Cl)(Cl)C[Si](C)(C)O1 |
| InChI | InChI=1S/C6H16OSi2.2ClH.Sn/c1-8(2,3)7-9(4,5)6;;;/h1,4H2,2-3,5-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ZHCAKSUZROLUKA-UHFFFAOYSA-L |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.98 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|