About 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid
3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid (PubChem CID 140927284) has the molecular formula C22H13F2NO2S
and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid.
Molecular Properties
| Compound Name | 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid |
| PubChem CID | 140927284 |
| Molecular Formula | C22H13F2NO2S |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid |
| SMILES | N#Cc1ccc(-c2cccc3sc(CC(F)(F)C(=O)O)cc23)c2ccccc12 |
| InChI | InChI=1S/C22H13F2NO2S/c23-22(24,21(26)27)11-14-10-19-17(6-3-7-20(19)28-14)18-9-8-13(12-25)15-4-1-2-5-16(15)18/h1-10H,11H2,(H,26,27) |
| InChIKey | MBPRGQJWDVJNJQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid?
The IUPAC name of 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid (CID 140927284) is 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid.
What is the SMILES notation for 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid?
The canonical SMILES for 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid is N#Cc1ccc(-c2cccc3sc(CC(F)(F)C(=O)O)cc23)c2ccccc12.
What is the InChIKey of 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid?
The InChIKey is MBPRGQJWDVJNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13F2NO2S/c23-22(24,21(26)27)11-14-10-19-17(6-3-7-20(19)28-14)18-9-8-13(12-25)15-4-1-2-5-16(15)18/h1-10H,11H2,(H,26,27).
What are the key properties of 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid?
3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid has a molecular weight of 393.41 g/mol, XLogP of 5.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-cyanonaphthalen-1-yl)-1-benzothiophen-2-yl]-2,2-difluoropropanoic acid is sourced from PubChem (CID 140927284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).