C27H16BF5O2 — CID 140927399
(Z)-3-diphenylboranyloxy-3-(2,3,4,5,6-pentafluorophenyl)-1-phenylprop-2-en-1-one (PubChem CID 140927399) has the molecular formula C27H16BF5O2 and a molecular weight of 478.23 g/mol. Its IUPAC name is (Z)-3-diphenylboranyloxy-3-(2,3,4,5,6-pentafluorophenyl)-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-3-diphenylboranyloxy-3-(2,3,4,5,6-pentafluorophenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 140927399 |
| Molecular Formula | C27H16BF5O2 |
| Molecular Weight | 478.23 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | (Z)-3-diphenylboranyloxy-3-(2,3,4,5,6-pentafluorophenyl)-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C(\OB(c1ccccc1)c1ccccc1)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C27H16BF5O2/c29-23-22(24(30)26(32)27(33)25(23)31)21(16-20(34)17-10-4-1-5-11-17)35-28(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H/b21-16- |
| InChIKey | QXNHHKQATHRTNU-PGMHBOJBSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.23 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|