About 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane
1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane (PubChem CID 140929454) has the molecular formula C11H22F2N2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane |
| PubChem CID | 140929454 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane |
| SMILES | CC(C)(C)N1CCCN(CC(F)F)CC1 |
| InChI | InChI=1S/C11H22F2N2/c1-11(2,3)15-6-4-5-14(7-8-15)9-10(12)13/h10H,4-9H2,1-3H3 |
| InChIKey | WPZWXCADCBNDIM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane?
The IUPAC name of 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane (CID 140929454) is 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane.
What is the SMILES notation for 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane?
The canonical SMILES for 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane is CC(C)(C)N1CCCN(CC(F)F)CC1.
What is the InChIKey of 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane?
The InChIKey is WPZWXCADCBNDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2/c1-11(2,3)15-6-4-5-14(7-8-15)9-10(12)13/h10H,4-9H2,1-3H3.
What are the key properties of 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane?
1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane has a molecular weight of 220.31 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(2,2-difluoroethyl)-1,4-diazepane is sourced from PubChem (CID 140929454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).