C11H19F2N — CID 140929495
(3aS,6aR)-2-tert-butyl-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 140929495) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is (3aS,6aR)-2-tert-butyl-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-2-tert-butyl-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 140929495 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (3aS,6aR)-2-tert-butyl-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | CC(C)(C)N1C[C@@H]2CC(F)(F)C[C@@H]2C1 |
| InChI | InChI=1S/C11H19F2N/c1-10(2,3)14-6-8-4-11(12,13)5-9(8)7-14/h8-9H,4-7H2,1-3H3/t8-,9+ |
| InChIKey | OYWRCLBFTREJRO-DTORHVGOSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |