C23H20ClN7O — CID 140929571
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-5-isocyanopyrazole-3-carboxamide (PubChem CID 140929571) has the molecular formula C23H20ClN7O and a molecular weight of 445.91 g/mol. Its IUPAC name is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-5-isocyanopyrazole-3-carboxamide.
| Compound Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-5-isocyanopyrazole-3-carboxamide |
|---|---|
| PubChem CID | 140929571 |
| Molecular Formula | C23H20ClN7O |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(3-chloroquinolin-6-yl)methyl]-5-isocyanopyrazole-3-carboxamide |
| SMILES | [C-]#[N+]c1cc(C(=O)NCc2c(C)cc(N)nc2C)nn1Cc1ccc2ncc(Cl)cc2c1 |
| InChI | InChI=1S/C23H20ClN7O/c1-13-6-21(25)29-14(2)18(13)11-28-23(32)20-9-22(26-3)31(30-20)12-15-4-5-19-16(7-15)8-17(24)10-27-19/h4-10H,11-12H2,1-2H3,(H2,25,29)(H,28,32) |
| InChIKey | MWRJMJVDNQRCNP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|