C32H37N3O3 — CID 140929661
(2R,4R,5R,6S,12S,14R,15S,17R)-15-(3-aminoazetidin-1-yl)-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-diene-4,5-diol (PubChem CID 140929661) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is (2R,4R,5R,6S,12S,14R,15S,17R)-15-(3-aminoazetidin-1-yl)-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-diene-4,5-diol.
| Compound Name | (2R,4R,5R,6S,12S,14R,15S,17R)-15-(3-aminoazetidin-1-yl)-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-diene-4,5-diol |
|---|---|
| PubChem CID | 140929661 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (2R,4R,5R,6S,12S,14R,15S,17R)-15-(3-aminoazetidin-1-yl)-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-diene-4,5-diol |
| SMILES | C[C@]12CC=C3C=C4[C@H]5C[C@H]5[C@@H](N5CC(N)C5)C[C@]45CCC3(O5)[C@@H]1C[C@@H](O)[C@]2(O)c1ccc2ccncc2c1 |
| InChI | InChI=1S/C32H37N3O3/c1-29-6-4-20-11-25-23-12-24(23)26(35-16-22(33)17-35)14-30(25)7-8-31(20,38-30)27(29)13-28(36)32(29,37)21-3-2-18-5-9-34-15-19(18)10-21/h2-5,9-11,15,22-24,26-28,36-37H,6-8,12-14,16-17,33H2,1H3/t23-,24+,26-,27+,28+,29-,30+,31?,32+/m0/s1 |
| InChIKey | DGEXHWIBGPTSKH-GSEBOTJZSA-N |
| XLogP | 3.42 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |