C33H39N3O2 — CID 140929705
(2R,4S,6S,7S,14R,15S,17R)-15-[(3R)-3-aminopyrrolidin-1-yl]-6-isoquinolin-7-yl-7-methyl-20-oxahexacyclo[15.2.1.01,10.02,7.04,6.012,17]icosa-9,11-dien-14-ol (PubChem CID 140929705) has the molecular formula C33H39N3O2 and a molecular weight of 509.69 g/mol. Its IUPAC name is (2R,4S,6S,7S,14R,15S,17R)-15-[(3R)-3-aminopyrrolidin-1-yl]-6-isoquinolin-7-yl-7-methyl-20-oxahexacyclo[15.2.1.01,10.02,7.04,6.012,17]icosa-9,11-dien-14-ol.
| Compound Name | (2R,4S,6S,7S,14R,15S,17R)-15-[(3R)-3-aminopyrrolidin-1-yl]-6-isoquinolin-7-yl-7-methyl-20-oxahexacyclo[15.2.1.01,10.02,7.04,6.012,17]icosa-9,11-dien-14-ol |
|---|---|
| PubChem CID | 140929705 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | (2R,4S,6S,7S,14R,15S,17R)-15-[(3R)-3-aminopyrrolidin-1-yl]-6-isoquinolin-7-yl-7-methyl-20-oxahexacyclo[15.2.1.01,10.02,7.04,6.012,17]icosa-9,11-dien-14-ol |
| SMILES | C[C@]12CC=C3C=C4C[C@@H](O)[C@@H](N5CC[C@@H](N)C5)C[C@]45CCC3(O5)[C@@H]1C[C@H]1C[C@]12c1ccc2ccncc2c1 |
| InChI | InChI=1S/C33H39N3O2/c1-30-7-4-23-13-24-14-28(37)27(36-11-6-26(34)19-36)17-31(24)8-9-33(23,38-31)29(30)15-25-16-32(25,30)22-3-2-20-5-10-35-18-21(20)12-22/h2-5,10,12-13,18,25-29,37H,6-9,11,14-17,19,34H2,1H3/t25-,26+,27-,28+,29+,30-,31+,32-,33?/m0/s1 |
| InChIKey | NNYCGHWPUHBNGS-TZYZPTMASA-N |
| XLogP | 4.63 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |