C33H38N2O4 — CID 140929756
(3S,4S)-1-[(2R,4R,5S,6R,12S,14R,15S,17R)-4-hydroxy-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-dien-15-yl]pyrrolidine-3,4-diol (PubChem CID 140929756) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is (3S,4S)-1-[(2R,4R,5S,6R,12S,14R,15S,17R)-4-hydroxy-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-dien-15-yl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4S)-1-[(2R,4R,5S,6R,12S,14R,15S,17R)-4-hydroxy-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-dien-15-yl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 140929756 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | (3S,4S)-1-[(2R,4R,5S,6R,12S,14R,15S,17R)-4-hydroxy-5-isoquinolin-7-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.011,17.012,14]icosa-8,10-dien-15-yl]pyrrolidine-3,4-diol |
| SMILES | C[C@]12CC=C3C=C4[C@H]5C[C@H]5[C@@H](N5C[C@H](O)[C@@H](O)C5)C[C@]45CCC3(O5)[C@@H]1C[C@@H](O)[C@@H]2c1ccc2ccncc2c1 |
| InChI | InChI=1S/C33H38N2O4/c1-31-6-4-21-11-24-22-12-23(22)25(35-16-27(37)28(38)17-35)14-32(24)7-8-33(21,39-32)29(31)13-26(36)30(31)19-3-2-18-5-9-34-15-20(18)10-19/h2-5,9-11,15,22-23,25-30,36-38H,6-8,12-14,16-17H2,1H3/t22-,23+,25-,26+,27-,28-,29+,30-,31-,32+,33?/m0/s1 |
| InChIKey | GDBSVKKYKLXHIB-ILFVZXAOSA-N |
| XLogP | 3.71 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |