C26H36N8O — CID 140930424
3-[(2R,3R)-1-[6-isocyano-5-[4-(4-methylpiperazin-1-yl)anilino]-3-pyridinyl]-2-methylpiperidin-3-yl]-1,1-dimethylurea (PubChem CID 140930424) has the molecular formula C26H36N8O and a molecular weight of 476.63 g/mol. Its IUPAC name is 3-[(2R,3R)-1-[6-isocyano-5-[4-(4-methylpiperazin-1-yl)anilino]-3-pyridinyl]-2-methylpiperidin-3-yl]-1,1-dimethylurea.
| Compound Name | 3-[(2R,3R)-1-[6-isocyano-5-[4-(4-methylpiperazin-1-yl)anilino]-3-pyridinyl]-2-methylpiperidin-3-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 140930424 |
| Molecular Formula | C26H36N8O |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 3-[(2R,3R)-1-[6-isocyano-5-[4-(4-methylpiperazin-1-yl)anilino]-3-pyridinyl]-2-methylpiperidin-3-yl]-1,1-dimethylurea |
| SMILES | [C-]#[N+]c1ncc(N2CCC[C@@H](NC(=O)N(C)C)[C@H]2C)cc1Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C26H36N8O/c1-19-23(30-26(35)31(3)4)7-6-12-34(19)22-17-24(25(27-2)28-18-22)29-20-8-10-21(11-9-20)33-15-13-32(5)14-16-33/h8-11,17-19,23,29H,6-7,12-16H2,1,3-5H3,(H,30,35)/t19-,23-/m1/s1 |
| InChIKey | HSIOYXKJDAFDQD-AUSIDOKSSA-N |
| XLogP | 3.76 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|