C35H40N10O2 — CID 140930536
4-[4-amino-1-[(3R)-1-[2-cyano-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enoyl]piperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]-N-pyridin-2-ylbenzamide (PubChem CID 140930536) has the molecular formula C35H40N10O2 and a molecular weight of 632.77 g/mol. Its IUPAC name is 4-[4-amino-1-[(3R)-1-[2-cyano-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enoyl]piperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[4-amino-1-[(3R)-1-[2-cyano-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enoyl]piperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 140930536 |
| Molecular Formula | C35H40N10O2 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | 4-[4-amino-1-[(3R)-1-[2-cyano-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enoyl]piperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]-N-pyridin-2-ylbenzamide |
| SMILES | CN1CCN(C(C)(C)C=C(C#N)C(=O)N2CCC[C@@H](n3nc(-c4ccc(C(=O)Nc5ccccn5)cc4)c4c(N)nccc43)C2)CC1 |
| InChI | InChI=1S/C35H40N10O2/c1-35(2,44-19-17-42(3)18-20-44)21-26(22-36)34(47)43-16-6-7-27(23-43)45-28-13-15-39-32(37)30(28)31(41-45)24-9-11-25(12-10-24)33(46)40-29-8-4-5-14-38-29/h4-5,8-15,21,27H,6-7,16-20,23H2,1-3H3,(H2,37,39)(H,38,40,46)/t27-/m1/s1 |
| InChIKey | UFSUUXWBEFVZML-HHHXNRCGSA-N |
| XLogP | 3.97 |
| TPSA | 149.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|