About 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene
1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene (PubChem CID 140930588) has the molecular formula C16H24Br2O4
and a molecular weight of 440.17 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene.
Molecular Properties
| Compound Name | 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene |
| PubChem CID | 140930588 |
| Molecular Formula | C16H24Br2O4 |
| Molecular Weight | 440.17 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene |
| SMILES | COC(C)(C)OCc1cc(Br)c(COC(C)(C)OC)cc1Br |
| InChI | InChI=1S/C16H24Br2O4/c1-15(2,19-5)21-9-11-7-14(18)12(8-13(11)17)10-22-16(3,4)20-6/h7-8H,9-10H2,1-6H3 |
| InChIKey | DYNAIJLDCCVIFG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.17 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene?
The IUPAC name of 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene (CID 140930588) is 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene.
What is the SMILES notation for 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene?
The canonical SMILES for 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene is COC(C)(C)OCc1cc(Br)c(COC(C)(C)OC)cc1Br.
What is the InChIKey of 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene?
The InChIKey is DYNAIJLDCCVIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24Br2O4/c1-15(2,19-5)21-9-11-7-14(18)12(8-13(11)17)10-22-16(3,4)20-6/h7-8H,9-10H2,1-6H3.
What are the key properties of 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene?
1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene has a molecular weight of 440.17 g/mol, XLogP of 5.01, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromo-2,5-bis(2-methoxypropan-2-yloxymethyl)benzene is sourced from PubChem (CID 140930588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).