About dimethyl siloxane acrylate
dimethyl siloxane acrylate (PubChem CID 140930855) has the molecular formula C5H8O3Si
and a molecular weight of 144.20 g/mol.
Molecular Properties
| Compound Name | dimethyl siloxane acrylate |
| PubChem CID | 140930855 |
| Molecular Formula | C5H8O3Si |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | — |
| SMILES | C/C=C(\C)C(=O)O[Si]O |
| InChI | InChI=1S/C5H8O3Si/c1-3-4(2)5(6)8-9-7/h3,7H,1-2H3/b4-3+ |
| InChIKey | YZLQVWHUKJWKPO-ONEGZZNKSA-N |
| XLogP | 0.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl siloxane acrylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl siloxane acrylate?
The IUPAC name of dimethyl siloxane acrylate (CID 140930855) is not available.
What is the SMILES notation for dimethyl siloxane acrylate?
The canonical SMILES for dimethyl siloxane acrylate is C/C=C(\C)C(=O)O[Si]O.
What is the InChIKey of dimethyl siloxane acrylate?
The InChIKey is YZLQVWHUKJWKPO-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H8O3Si/c1-3-4(2)5(6)8-9-7/h3,7H,1-2H3/b4-3+.
What are the key properties of dimethyl siloxane acrylate?
dimethyl siloxane acrylate has a molecular weight of 144.20 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl siloxane acrylate is sourced from PubChem (CID 140930855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).