C14H16ClNO4 — CID 140931092
diethyl 2-(3-chloro-2,4,5,6-tetradeuteriophenyl)iminobutanedioate (PubChem CID 140931092) has the molecular formula C14H16ClNO4 and a molecular weight of 301.76 g/mol. Its IUPAC name is diethyl 2-(3-chloro-2,4,5,6-tetradeuteriophenyl)iminobutanedioate.
| Compound Name | diethyl 2-(3-chloro-2,4,5,6-tetradeuteriophenyl)iminobutanedioate |
|---|---|
| PubChem CID | 140931092 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | diethyl 2-(3-chloro-2,4,5,6-tetradeuteriophenyl)iminobutanedioate |
| SMILES | [2H]c1c([2H])c(Cl)c([2H])c(/N=C(\CC(=O)OCC)C(=O)OCC)c1[2H] |
| InChI | InChI=1S/C14H16ClNO4/c1-3-19-13(17)9-12(14(18)20-4-2)16-11-7-5-6-10(15)8-11/h5-8H,3-4,9H2,1-2H3/b16-12+/i5D,6D,7D,8D |
| InChIKey | CRVKAJHAUYCUDQ-SVZIQPPESA-N |
| XLogP | 2.93 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|