About 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid
7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid (PubChem CID 140931101) has the molecular formula C10H6ClNO3
and a molecular weight of 226.63 g/mol. Its IUPAC name is 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid |
| PubChem CID | 140931101 |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 226.63 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid |
| SMILES | [2H]c1c(Cl)c([2H])c2[nH]c(C(=O)O)cc(=O)c2c1[2H] |
| InChI | InChI=1S/C10H6ClNO3/c11-5-1-2-6-7(3-5)12-8(10(14)15)4-9(6)13/h1-4H,(H,12,13)(H,14,15)/i1D,2D,3D |
| InChIKey | UAWVRVFHMOSAPU-CBYSEHNBSA-N |
| XLogP | 1.88 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid?
The IUPAC name of 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid (CID 140931101) is 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid.
What is the SMILES notation for 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid?
The canonical SMILES for 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid is [2H]c1c(Cl)c([2H])c2[nH]c(C(=O)O)cc(=O)c2c1[2H].
What is the InChIKey of 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid?
The InChIKey is UAWVRVFHMOSAPU-CBYSEHNBSA-N. The full InChI is InChI=1S/C10H6ClNO3/c11-5-1-2-6-7(3-5)12-8(10(14)15)4-9(6)13/h1-4H,(H,12,13)(H,14,15)/i1D,2D,3D.
What are the key properties of 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid?
7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid has a molecular weight of 226.63 g/mol, XLogP of 1.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5,6,8-trideuterio-4-oxo-1H-quinoline-2-carboxylic acid is sourced from PubChem (CID 140931101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).