C24H32N2O2 — CID 140931186
N-ethyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]benzamide (PubChem CID 140931186) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-ethyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]benzamide.
| Compound Name | N-ethyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 140931186 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-ethyl-N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]benzamide |
| SMILES | CCN(CC1CCCN(CCc2cccc(OC)c2)C1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O2/c1-3-26(24(27)22-11-5-4-6-12-22)19-21-10-8-15-25(18-21)16-14-20-9-7-13-23(17-20)28-2/h4-7,9,11-13,17,21H,3,8,10,14-16,18-19H2,1-2H3 |
| InChIKey | XANWJTQHXKVKOI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |