C15H14F3NO5S2 — CID 140931341
N-[methylsulfonyl-[2-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide (PubChem CID 140931341) has the molecular formula C15H14F3NO5S2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[methylsulfonyl-[2-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide.
| Compound Name | N-[methylsulfonyl-[2-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 140931341 |
| Molecular Formula | C15H14F3NO5S2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-[methylsulfonyl-[2-(trifluoromethyl)phenyl]methoxy]benzenesulfonamide |
| SMILES | CS(=O)(=O)C(ONS(=O)(=O)c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO5S2/c1-25(20,21)14(12-9-5-6-10-13(12)15(16,17)18)24-19-26(22,23)11-7-3-2-4-8-11/h2-10,14,19H,1H3 |
| InChIKey | UWNUWIXSMDNXLK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|