C4HCl5O — CID 14093179
1,1,3,4,4-pentachlorobut-3-en-2-one (PubChem CID 14093179) has the molecular formula C4HCl5O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,1,3,4,4-pentachlorobut-3-en-2-one.
| Compound Name | 1,1,3,4,4-pentachlorobut-3-en-2-one |
|---|---|
| PubChem CID | 14093179 |
| Molecular Formula | C4HCl5O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 239.85 |
| IUPAC Name | 1,1,3,4,4-pentachlorobut-3-en-2-one |
| SMILES | O=C(C(Cl)=C(Cl)Cl)C(Cl)Cl |
| InChI | InChI=1S/C4HCl5O/c5-1(3(6)7)2(10)4(8)9/h4H |
| InChIKey | ZLJDCVIOYAVBEO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|