C23H20N4 — CID 140932430
1,2-dimethyl-3-(1-methyl-3-phenyl-2H-pyridin-1-ium-2-id-6-yl)imidazo[1,2-a]benzimidazole (PubChem CID 140932430) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1,2-dimethyl-3-(1-methyl-3-phenyl-2H-pyridin-1-ium-2-id-6-yl)imidazo[1,2-a]benzimidazole.
| Compound Name | 1,2-dimethyl-3-(1-methyl-3-phenyl-2H-pyridin-1-ium-2-id-6-yl)imidazo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 140932430 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1,2-dimethyl-3-(1-methyl-3-phenyl-2H-pyridin-1-ium-2-id-6-yl)imidazo[1,2-a]benzimidazole |
| SMILES | Cc1c(C)n2c3ccccc3nc2n1-c1ccc(-c2ccccc2)[c-][n+]1C |
| InChI | InChI=1S/C23H20N4/c1-16-17(2)27(23-24-20-11-7-8-12-21(20)26(16)23)22-14-13-19(15-25(22)3)18-9-5-4-6-10-18/h4-14H,1-3H3 |
| InChIKey | OANAHNDQEPQYEI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|