C11H12F2N6 — CID 140932756
3-[5-(azidomethyl)-4-methylpyrimidin-2-yl]-6,6-difluoro-3-azabicyclo[3.1.0]hexane (PubChem CID 140932756) has the molecular formula C11H12F2N6 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-[5-(azidomethyl)-4-methylpyrimidin-2-yl]-6,6-difluoro-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-[5-(azidomethyl)-4-methylpyrimidin-2-yl]-6,6-difluoro-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 140932756 |
| Molecular Formula | C11H12F2N6 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[5-(azidomethyl)-4-methylpyrimidin-2-yl]-6,6-difluoro-3-azabicyclo[3.1.0]hexane |
| SMILES | Cc1nc(N2CC3C(C2)C3(F)F)ncc1CN=[N+]=[N-] |
| InChI | InChI=1S/C11H12F2N6/c1-6-7(3-16-18-14)2-15-10(17-6)19-4-8-9(5-19)11(8,12)13/h2,8-9H,3-5H2,1H3 |
| InChIKey | TXHZFSIAYPGJIB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|