About 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol
4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 140933699) has the molecular formula C18H18O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 140933699 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2c(-c3cccc4c3CCC4O)cccc21 |
| InChI | InChI=1S/C18H18O2/c19-17-9-7-13-11(3-1-5-15(13)17)12-4-2-6-16-14(12)8-10-18(16)20/h1-6,17-20H,7-10H2 |
| InChIKey | PRZYQZDRUFOWJL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol (CID 140933699) is 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol is OC1CCc2c(-c3cccc4c3CCC4O)cccc21.
What is the InChIKey of 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is PRZYQZDRUFOWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2/c19-17-9-7-13-11(3-1-5-15(13)17)12-4-2-6-16-14(12)8-10-18(16)20/h1-6,17-20H,7-10H2.
What are the key properties of 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol?
4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 266.34 g/mol, XLogP of 3.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 140933699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).