C25H32N4O4 — CID 140933955
4-[4-(2-methoxyethoxy)-5,5-dimethyl-4H-1,2-oxazol-3-yl]-N-piperidin-3-yl-N-pyridin-2-ylbenzamide (PubChem CID 140933955) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 4-[4-(2-methoxyethoxy)-5,5-dimethyl-4H-1,2-oxazol-3-yl]-N-piperidin-3-yl-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[4-(2-methoxyethoxy)-5,5-dimethyl-4H-1,2-oxazol-3-yl]-N-piperidin-3-yl-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 140933955 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 4-[4-(2-methoxyethoxy)-5,5-dimethyl-4H-1,2-oxazol-3-yl]-N-piperidin-3-yl-N-pyridin-2-ylbenzamide |
| SMILES | COCCOC1C(c2ccc(C(=O)N(c3ccccn3)C3CCCNC3)cc2)=NOC1(C)C |
| InChI | InChI=1S/C25H32N4O4/c1-25(2)23(32-16-15-31-3)22(28-33-25)18-9-11-19(12-10-18)24(30)29(20-7-6-13-26-17-20)21-8-4-5-14-27-21/h4-5,8-12,14,20,23,26H,6-7,13,15-17H2,1-3H3 |
| InChIKey | WYKXSLGEOPPTPT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|