C24H29N5O3 — CID 140934003
4-[(4Z)-4-methoxyimino-5,5-dimethyl-1,2-oxazol-3-yl]-N-(3-methyl-2-pyridinyl)-N-[(3R)-piperidin-3-yl]benzamide (PubChem CID 140934003) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-[(4Z)-4-methoxyimino-5,5-dimethyl-1,2-oxazol-3-yl]-N-(3-methyl-2-pyridinyl)-N-[(3R)-piperidin-3-yl]benzamide.
| Compound Name | 4-[(4Z)-4-methoxyimino-5,5-dimethyl-1,2-oxazol-3-yl]-N-(3-methyl-2-pyridinyl)-N-[(3R)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 140934003 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 4-[(4Z)-4-methoxyimino-5,5-dimethyl-1,2-oxazol-3-yl]-N-(3-methyl-2-pyridinyl)-N-[(3R)-piperidin-3-yl]benzamide |
| SMILES | CO/N=C1/C(c2ccc(C(=O)N(c3ncccc3C)[C@@H]3CCCNC3)cc2)=NOC1(C)C |
| InChI | InChI=1S/C24H29N5O3/c1-16-7-5-14-26-22(16)29(19-8-6-13-25-15-19)23(30)18-11-9-17(10-12-18)20-21(28-31-4)24(2,3)32-27-20/h5,7,9-12,14,19,25H,6,8,13,15H2,1-4H3/b28-21-/t19-/m1/s1 |
| InChIKey | CUXGNOZKDNLEJB-GVHIXNLUSA-N |
| XLogP | 3.30 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|