C44H34N4 — CID 140934353
1-[1-tert-butyl-4-[4-(4-phenyl-2-pyridinyl)naphthalen-2-yl]benzimidazol-2-yl]-9H-carbazole (PubChem CID 140934353) has the molecular formula C44H34N4 and a molecular weight of 618.78 g/mol. Its IUPAC name is 1-[1-tert-butyl-4-[4-(4-phenyl-2-pyridinyl)naphthalen-2-yl]benzimidazol-2-yl]-9H-carbazole.
| Compound Name | 1-[1-tert-butyl-4-[4-(4-phenyl-2-pyridinyl)naphthalen-2-yl]benzimidazol-2-yl]-9H-carbazole |
|---|---|
| PubChem CID | 140934353 |
| Molecular Formula | C44H34N4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 1-[1-tert-butyl-4-[4-(4-phenyl-2-pyridinyl)naphthalen-2-yl]benzimidazol-2-yl]-9H-carbazole |
| SMILES | CC(C)(C)n1c(-c2cccc3c2[nH]c2ccccc23)nc2c(-c3cc(-c4cc(-c5ccccc5)ccn4)c4ccccc4c3)cccc21 |
| InChI | InChI=1S/C44H34N4/c1-44(2,3)48-40-22-12-18-33(42(40)47-43(48)36-20-11-19-35-34-17-9-10-21-38(34)46-41(35)36)31-25-30-15-7-8-16-32(30)37(26-31)39-27-29(23-24-45-39)28-13-5-4-6-14-28/h4-27,46H,1-3H3 |
| InChIKey | ZZIPDFXPYMATHJ-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |