C21H18F25O4P — CID 140934927
diethyl 4,4,5,5,6,6,7,7,8,8,9,9,12,12,13,13,14,14,15,15,16,16,17,17,17-pentacosafluoroheptadec-10-enyl phosphate (PubChem CID 140934927) has the molecular formula C21H18F25O4P and a molecular weight of 840.29 g/mol. Its IUPAC name is diethyl 4,4,5,5,6,6,7,7,8,8,9,9,12,12,13,13,14,14,15,15,16,16,17,17,17-pentacosafluoroheptadec-10-enyl phosphate.
| Compound Name | diethyl 4,4,5,5,6,6,7,7,8,8,9,9,12,12,13,13,14,14,15,15,16,16,17,17,17-pentacosafluoroheptadec-10-enyl phosphate |
|---|---|
| PubChem CID | 140934927 |
| Molecular Formula | C21H18F25O4P |
| Molecular Weight | 840.29 g/mol |
| Exact Mass | 840.05 |
| IUPAC Name | diethyl 4,4,5,5,6,6,7,7,8,8,9,9,12,12,13,13,14,14,15,15,16,16,17,17,17-pentacosafluoroheptadec-10-enyl phosphate |
| SMILES | CCOP(=O)(OCC)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H18F25O4P/c1-3-48-51(47,49-4-2)50-9-5-6-10(22,23)13(28,29)16(34,35)17(36,37)14(30,31)11(24,25)7-8-12(26,27)15(32,33)18(38,39)19(40,41)20(42,43)21(44,45)46/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | XAXWPGNCFHVCDO-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.29 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|