C23H37N9O — CID 140935152
2-[8-[2-imino-3-[2-[[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinyl]oxy]ethyl]imidazol-1-yl]octyl]guanidine (PubChem CID 140935152) has the molecular formula C23H37N9O and a molecular weight of 455.61 g/mol. Its IUPAC name is 2-[8-[2-imino-3-[2-[[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinyl]oxy]ethyl]imidazol-1-yl]octyl]guanidine.
| Compound Name | 2-[8-[2-imino-3-[2-[[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinyl]oxy]ethyl]imidazol-1-yl]octyl]guanidine |
|---|---|
| PubChem CID | 140935152 |
| Molecular Formula | C23H37N9O |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | 2-[8-[2-imino-3-[2-[[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinyl]oxy]ethyl]imidazol-1-yl]octyl]guanidine |
| SMILES | [H]/N=c1\n(CCCCCCCCN=C(N)N)ccn1CCOc1ccc(C2=NCCCN2)nc1 |
| InChI | InChI=1S/C23H37N9O/c24-22(25)29-10-5-3-1-2-4-6-13-31-14-15-32(23(31)26)16-17-33-19-8-9-20(30-18-19)21-27-11-7-12-28-21/h8-9,14-15,18,26H,1-7,10-13,16-17H2,(H,27,28)(H4,24,25,29)/b26-23+ |
| InChIKey | CULQHSMYHKRSTA-WNAAXNPUSA-N |
| XLogP | 1.60 |
| TPSA | 144.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|