About ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate
ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate (PubChem CID 140935256) has the molecular formula C15H15F2NO2S
and a molecular weight of 311.35 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate.
Molecular Properties
| Compound Name | ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate |
| PubChem CID | 140935256 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1ccc(-c2cc(F)ccc2F)s1 |
| InChI | InChI=1S/C15H15F2NO2S/c1-2-20-15(19)8-12(18)14-6-5-13(21-14)10-7-9(16)3-4-11(10)17/h3-7,12H,2,8,18H2,1H3/t12-/m0/s1 |
| InChIKey | KONZOSLBFHODII-LBPRGKRZSA-N |
| XLogP | 3.65 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate?
The IUPAC name of ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate (CID 140935256) is ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate.
What is the SMILES notation for ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate?
The canonical SMILES for ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate is CCOC(=O)C[C@H](N)c1ccc(-c2cc(F)ccc2F)s1.
What is the InChIKey of ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate?
The InChIKey is KONZOSLBFHODII-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H15F2NO2S/c1-2-20-15(19)8-12(18)14-6-5-13(21-14)10-7-9(16)3-4-11(10)17/h3-7,12H,2,8,18H2,1H3/t12-/m0/s1.
What are the key properties of ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate?
ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate has a molecular weight of 311.35 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-3-amino-3-[5-(2,5-difluorophenyl)thiophen-2-yl]propanoate is sourced from PubChem (CID 140935256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).