C17H17F2NO2 — CID 140935831
ethyl (3S)-3-amino-3-[3-(3,4-difluorophenyl)phenyl]propanoate (PubChem CID 140935831) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[3-(3,4-difluorophenyl)phenyl]propanoate.
| Compound Name | ethyl (3S)-3-amino-3-[3-(3,4-difluorophenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 140935831 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | ethyl (3S)-3-amino-3-[3-(3,4-difluorophenyl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1cccc(-c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H17F2NO2/c1-2-22-17(21)10-16(20)13-5-3-4-11(8-13)12-6-7-14(18)15(19)9-12/h3-9,16H,2,10,20H2,1H3/t16-/m0/s1 |
| InChIKey | LSGNZGLPXDNEMU-INIZCTEOSA-N |
| XLogP | 3.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |