C40H56BNO3 — CID 140936528
2-(3,6-ditert-butylcarbazol-9-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 140936528) has the molecular formula C40H56BNO3 and a molecular weight of 609.70 g/mol. Its IUPAC name is 2-(3,6-ditert-butylcarbazol-9-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(3,6-ditert-butylcarbazol-9-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 140936528 |
| Molecular Formula | C40H56BNO3 |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.44 |
| IUPAC Name | 2-(3,6-ditert-butylcarbazol-9-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(B2OC(C)(C)C(C)(C)O2)c(O)c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C40H56BNO3/c1-35(2,3)24-38(10,11)27-22-30(41-44-39(12,13)40(14,15)45-41)34(43)33(23-27)42-31-18-16-25(36(4,5)6)20-28(31)29-21-26(37(7,8)9)17-19-32(29)42/h16-23,43H,24H2,1-15H3 |
| InChIKey | UDMZCWUVRVOKIZ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|