C16H17NO3 — CID 14093654
2-[(2-hydroxy-1,2-diphenylethyl)amino]acetic acid (PubChem CID 14093654) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[(2-hydroxy-1,2-diphenylethyl)amino]acetic acid.
| Compound Name | 2-[(2-hydroxy-1,2-diphenylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 14093654 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[(2-hydroxy-1,2-diphenylethyl)amino]acetic acid |
| SMILES | O=C(O)CNC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c18-14(19)11-17-15(12-7-3-1-4-8-12)16(20)13-9-5-2-6-10-13/h1-10,15-17,20H,11H2,(H,18,19) |
| InChIKey | GZQBQURPFATDQM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |