C20H32N4O2 — CID 140936830
tert-butyl 4-[6-(4-methylcyclohexyl)pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 140936830) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl 4-[6-(4-methylcyclohexyl)pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(4-methylcyclohexyl)pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140936830 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | tert-butyl 4-[6-(4-methylcyclohexyl)pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CC1CCC(c2cncc(N3CCN(C(=O)OC(C)(C)C)CC3)n2)CC1 |
| InChI | InChI=1S/C20H32N4O2/c1-15-5-7-16(8-6-15)17-13-21-14-18(22-17)23-9-11-24(12-10-23)19(25)26-20(2,3)4/h13-16H,5-12H2,1-4H3 |
| InChIKey | MDZYKOSVRIOMFZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |