C44H40O2SSi — CID 140937389
1-[3-[3-(9,9-dimethylthioxanthen-4-yl)-2-(trideuteriomethyl)phenyl]-2,6-bis(trideuteriomethyl)phenyl]-6,6-dimethylbenzo[c][1,5,2]benzodioxasilepine (PubChem CID 140937389) has the molecular formula C44H40O2SSi and a molecular weight of 670.01 g/mol. Its IUPAC name is 1-[3-[3-(9,9-dimethylthioxanthen-4-yl)-2-(trideuteriomethyl)phenyl]-2,6-bis(trideuteriomethyl)phenyl]-6,6-dimethylbenzo[c][1,5,2]benzodioxasilepine.
| Compound Name | 1-[3-[3-(9,9-dimethylthioxanthen-4-yl)-2-(trideuteriomethyl)phenyl]-2,6-bis(trideuteriomethyl)phenyl]-6,6-dimethylbenzo[c][1,5,2]benzodioxasilepine |
|---|---|
| PubChem CID | 140937389 |
| Molecular Formula | C44H40O2SSi |
| Molecular Weight | 670.01 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | 1-[3-[3-(9,9-dimethylthioxanthen-4-yl)-2-(trideuteriomethyl)phenyl]-2,6-bis(trideuteriomethyl)phenyl]-6,6-dimethylbenzo[c][1,5,2]benzodioxasilepine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cccc(-c3cccc4c3Sc3ccccc3C4(C)C)c2C([2H])([2H])[2H])c(C([2H])([2H])[2H])c1-c1cccc2c1Oc1ccccc1[Si](C)(C)O2 |
| InChI | InChI=1S/C44H40O2SSi/c1-27-25-26-32(29(3)41(27)34-18-14-22-38-42(34)45-37-21-9-11-24-40(37)48(6,7)46-38)30-15-12-16-31(28(30)2)33-17-13-20-36-43(33)47-39-23-10-8-19-35(39)44(36,4)5/h8-26H,1-7H3/i1D3,2D3,3D3 |
| InChIKey | BATFMICNLJEPLO-GQALSZNTSA-N |
| XLogP | 12.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.01 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|