C27H29N3O3 — CID 140937665
(E)-N-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropanoyl]amino]propyl]-4-methylpent-2-enamide (PubChem CID 140937665) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is (E)-N-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropanoyl]amino]propyl]-4-methylpent-2-enamide.
| Compound Name | (E)-N-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropanoyl]amino]propyl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 140937665 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (E)-N-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropanoyl]amino]propyl]-4-methylpent-2-enamide |
| SMILES | CC(C)/C=C/C(=O)NCCCNC(=O)CC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C27H29N3O3/c1-20(2)12-15-25(31)28-16-7-17-29-26(32)18-27(33)30-19-23-10-4-3-8-21(23)13-14-22-9-5-6-11-24(22)30/h3-6,8-12,15,20H,7,16-19H2,1-2H3,(H,28,31)(H,29,32)/b15-12+ |
| InChIKey | DOGQKXYKDXWXIO-NTCAYCPXSA-N |
| XLogP | 3.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|