About CID 140937992
CID 140937992 (PubChem CID 140937992) has the molecular formula C11H7NO2SSi
and a molecular weight of 245.34 g/mol.
Molecular Properties
| Compound Name | CID 140937992 |
| PubChem CID | 140937992 |
| Molecular Formula | C11H7NO2SSi |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | — |
| SMILES | O=S1(=O)c2ccccc2[Si]c2ncccc21 |
| InChI | InChI=1S/C11H7NO2SSi/c13-15(14)8-4-1-2-6-10(8)16-11-9(15)5-3-7-12-11/h1-7H |
| InChIKey | ABQXELGNPNIEKW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140937992 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140937992?
The IUPAC name of CID 140937992 (CID 140937992) is not available.
What is the SMILES notation for CID 140937992?
The canonical SMILES for CID 140937992 is O=S1(=O)c2ccccc2[Si]c2ncccc21.
What is the InChIKey of CID 140937992?
The InChIKey is ABQXELGNPNIEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO2SSi/c13-15(14)8-4-1-2-6-10(8)16-11-9(15)5-3-7-12-11/h1-7H.
What are the key properties of CID 140937992?
CID 140937992 has a molecular weight of 245.34 g/mol, XLogP of -0.12, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140937992 is sourced from PubChem (CID 140937992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).